C24H36NP — CID 167454576
di(propan-2-yl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;prop-1-ene (PubChem CID 167454576) has the molecular formula C24H36NP and a molecular weight of 369.53 g/mol. Its IUPAC name is di(propan-2-yl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;prop-1-ene.
| Compound Name | di(propan-2-yl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;prop-1-ene |
|---|---|
| PubChem CID | 167454576 |
| Molecular Formula | C24H36NP |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | di(propan-2-yl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;prop-1-ene |
| SMILES | C=CC.Cc1cc(C)c(-c2cccc(CP(C(C)C)C(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C21H30NP.C3H6/c1-14(2)23(15(3)4)13-19-9-8-10-20(22-19)21-17(6)11-16(5)12-18(21)7;1-3-2/h8-12,14-15H,13H2,1-7H3;3H,1H2,2H3 |
| InChIKey | HEZFCFVRASJRNG-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|