C33H39N2+ — CID 142140371
[2,6-di(propan-2-yl)phenyl]-[phenyl-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]azanium (PubChem CID 142140371) has the molecular formula C33H39N2+ and a molecular weight of 463.69 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-[phenyl-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]azanium.
| Compound Name | [2,6-di(propan-2-yl)phenyl]-[phenyl-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]azanium |
|---|---|
| PubChem CID | 142140371 |
| Molecular Formula | C33H39N2+ |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-[phenyl-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]azanium |
| SMILES | Cc1cc(C)c(-c2cccc(C([NH2+]c3c(C(C)C)cccc3C(C)C)c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C33H38N2/c1-21(2)27-15-11-16-28(22(3)4)33(27)35-32(26-13-9-8-10-14-26)30-18-12-17-29(34-30)31-24(6)19-23(5)20-25(31)7/h8-22,32,35H,1-7H3/p+1 |
| InChIKey | RXYNWMFTYBPOKQ-UHFFFAOYSA-O |
| XLogP | 7.91 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|