C9H11Br3N2O2 — CID 58764863
1-[4-(2,2,2-tribromoacetyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 58764863) has the molecular formula C9H11Br3N2O2 and a molecular weight of 418.91 g/mol. Its IUPAC name is 1-[4-(2,2,2-tribromoacetyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(2,2,2-tribromoacetyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 58764863 |
| Molecular Formula | C9H11Br3N2O2 |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 415.84 |
| IUPAC Name | 1-[4-(2,2,2-tribromoacetyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)C(Br)(Br)Br)CC1 |
| InChI | InChI=1S/C9H11Br3N2O2/c1-2-7(15)13-3-5-14(6-4-13)8(16)9(10,11)12/h2H,1,3-6H2 |
| InChIKey | JCRGWNLCFOBDLX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|