C16H16F3NOS — CID 58765727
2-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanal (PubChem CID 58765727) has the molecular formula C16H16F3NOS and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanal.
| Compound Name | 2-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanal |
|---|---|
| PubChem CID | 58765727 |
| Molecular Formula | C16H16F3NOS |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propanal |
| SMILES | CC(C)c1nc(-c2ccc(C(F)(F)F)cc2)sc1C(C)C=O |
| InChI | InChI=1S/C16H16F3NOS/c1-9(2)13-14(10(3)8-21)22-15(20-13)11-4-6-12(7-5-11)16(17,18)19/h4-10H,1-3H3 |
| InChIKey | NWBCYWYVUQIENN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|