C17H18F3NOS — CID 69055704
5-(1-methoxyprop-1-en-2-yl)-4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 69055704) has the molecular formula C17H18F3NOS and a molecular weight of 341.40 g/mol. Its IUPAC name is 5-(1-methoxyprop-1-en-2-yl)-4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 5-(1-methoxyprop-1-en-2-yl)-4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 69055704 |
| Molecular Formula | C17H18F3NOS |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-(1-methoxyprop-1-en-2-yl)-4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | COC=C(C)c1sc(-c2ccc(C(F)(F)F)cc2)nc1C(C)C |
| InChI | InChI=1S/C17H18F3NOS/c1-10(2)14-15(11(3)9-22-4)23-16(21-14)12-5-7-13(8-6-12)17(18,19)20/h5-10H,1-4H3 |
| InChIKey | MLIMECSQKFQKEU-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|