C25H24F3NO3S — CID 67418256
1-[4-(methoxymethoxy)-3-methylphenyl]-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]prop-2-en-1-one (PubChem CID 67418256) has the molecular formula C25H24F3NO3S and a molecular weight of 475.53 g/mol. Its IUPAC name is 1-[4-(methoxymethoxy)-3-methylphenyl]-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(methoxymethoxy)-3-methylphenyl]-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 67418256 |
| Molecular Formula | C25H24F3NO3S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 1-[4-(methoxymethoxy)-3-methylphenyl]-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]prop-2-en-1-one |
| SMILES | COCOc1ccc(C(=O)C=Cc2sc(-c3ccc(C(F)(F)F)cc3)nc2C(C)C)cc1C |
| InChI | InChI=1S/C25H24F3NO3S/c1-15(2)23-22(33-24(29-23)17-5-8-19(9-6-17)25(26,27)28)12-10-20(30)18-7-11-21(16(3)13-18)32-14-31-4/h5-13,15H,14H2,1-4H3 |
| InChIKey | OGFBGZJHMMKJHG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|