C28H30Cl2F3NO3S — CID 143723845
2-[2,3-dichloro-4-[3-ethoxy-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]butanal (PubChem CID 143723845) has the molecular formula C28H30Cl2F3NO3S and a molecular weight of 588.52 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-[3-ethoxy-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]butanal.
| Compound Name | 2-[2,3-dichloro-4-[3-ethoxy-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]butanal |
|---|---|
| PubChem CID | 143723845 |
| Molecular Formula | C28H30Cl2F3NO3S |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 2-[2,3-dichloro-4-[3-ethoxy-3-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]propyl]phenoxy]butanal |
| SMILES | CCOC(CCc1ccc(OC(C=O)CC)c(Cl)c1Cl)c1sc(-c2ccc(C(F)(F)F)cc2)nc1C(C)C |
| InChI | InChI=1S/C28H30Cl2F3NO3S/c1-5-20(15-35)37-21-13-9-17(23(29)24(21)30)10-14-22(36-6-2)26-25(16(3)4)34-27(38-26)18-7-11-19(12-8-18)28(31,32)33/h7-9,11-13,15-16,20,22H,5-6,10,14H2,1-4H3 |
| InChIKey | OSPLEZZMQCOXDZ-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|