C19H24N2O4 — CID 58767416
tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methyl-3,6-dioxopiperazine-1-carboxylate (PubChem CID 58767416) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methyl-3,6-dioxopiperazine-1-carboxylate.
| Compound Name | tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methyl-3,6-dioxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58767416 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl (2E,5R)-4-benzyl-2-ethylidene-5-methyl-3,6-dioxopiperazine-1-carboxylate |
| SMILES | C/C=C1\C(=O)N(Cc2ccccc2)[C@H](C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N2O4/c1-6-15-17(23)20(12-14-10-8-7-9-11-14)13(2)16(22)21(15)18(24)25-19(3,4)5/h6-11,13H,12H2,1-5H3/b15-6+/t13-/m1/s1 |
| InChIKey | KDKFJOKCLSZOBP-WXYNBALXSA-N |
| XLogP | 3.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|