C18H24FN — CID 58772016
1-(2-bicyclo[2.2.1]heptanyl)-4-(2-fluorophenyl)piperidine (PubChem CID 58772016) has the molecular formula C18H24FN and a molecular weight of 273.39 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4-(2-fluorophenyl)piperidine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-(2-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 58772016 |
| Molecular Formula | C18H24FN |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-(2-fluorophenyl)piperidine |
| SMILES | Fc1ccccc1C1CCN(C2CC3CCC2C3)CC1 |
| InChI | InChI=1S/C18H24FN/c19-17-4-2-1-3-16(17)14-7-9-20(10-8-14)18-12-13-5-6-15(18)11-13/h1-4,13-15,18H,5-12H2 |
| InChIKey | LMJQGNGPCJADNA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |