C10H10F8O — CID 58773390
2-(2,3-difluoro-2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58773390) has the molecular formula C10H10F8O and a molecular weight of 298.17 g/mol. Its IUPAC name is 2-(2,3-difluoro-2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2,3-difluoro-2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58773390 |
| Molecular Formula | C10H10F8O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(2,3-difluoro-2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C1(F)C2CCC(C2)C1F |
| InChI | InChI=1S/C10H10F8O/c11-6-4-1-2-5(3-4)7(6,12)8(19,9(13,14)15)10(16,17)18/h4-6,19H,1-3H2 |
| InChIKey | LBZGNYAFXBEEMF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |