C17H22F12O — CID 91018341
1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]heptanyl)propan-2-ol;3-methyl-3-(trifluoromethyl)pentane (PubChem CID 91018341) has the molecular formula C17H22F12O and a molecular weight of 470.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]heptanyl)propan-2-ol;3-methyl-3-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]heptanyl)propan-2-ol;3-methyl-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 91018341 |
| Molecular Formula | C17H22F12O |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]heptanyl)propan-2-ol;3-methyl-3-(trifluoromethyl)pentane |
| SMILES | CCC(C)(CC)C(F)(F)F.OC(C(F)(F)F)(C(F)(F)F)C1(F)C2CCC(C2)C1(F)F |
| InChI | InChI=1S/C10H9F9O.C7H13F3/c11-6(4-1-2-5(3-4)7(6,12)13)8(20,9(14,15)16)10(17,18)19;1-4-6(3,5-2)7(8,9)10/h4-5,20H,1-3H2;4-5H2,1-3H3 |
| InChIKey | ZQPJWKLQIPJUSQ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |