C36H34N4O7 — CID 58774074
2-(4-nitrophenyl)ethyl 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-3,6,7,8-tetrahydrocyclopenta[e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 58774074) has the molecular formula C36H34N4O7 and a molecular weight of 634.69 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-3,6,7,8-tetrahydrocyclopenta[e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | 2-(4-nitrophenyl)ethyl 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-3,6,7,8-tetrahydrocyclopenta[e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 58774074 |
| Molecular Formula | C36H34N4O7 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-3,6,7,8-tetrahydrocyclopenta[e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCc2c1ccc1[nH]c(C(=O)N3CCc4c3ccc3[nH]c(C(=O)OCCc5ccc([N+](=O)[O-])cc5)cc43)cc21 |
| InChI | InChI=1S/C36H34N4O7/c1-36(2,3)47-34(42)25-9-8-23-22(25)10-11-28-26(23)18-30(37-28)33(41)39-16-14-24-27-19-31(38-29(27)12-13-32(24)39)35(43)46-17-15-20-4-6-21(7-5-20)40(44)45/h4-7,10-13,18-19,25,37-38H,8-9,14-17H2,1-3H3 |
| InChIKey | SZQZIUFNNLMPSI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|