C25H27F3N2O2S — CID 58779401
N-[(2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 58779401) has the molecular formula C25H27F3N2O2S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[(2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58779401 |
| Molecular Formula | C25H27F3N2O2S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[(2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(N[C@H]1CCCCC1NS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H27F3N2O2S/c1-17(21-10-6-8-18-7-2-3-9-22(18)21)29-23-11-4-5-12-24(23)30-33(31,32)20-15-13-19(14-16-20)25(26,27)28/h2-3,6-10,13-17,23-24,29-30H,4-5,11-12H2,1H3/t17?,23-,24?/m0/s1 |
| InChIKey | ULFCONGTFKAEBS-JXKJCSFESA-N |
| XLogP | 5.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |