C32H35Cl2N3O4 — CID 58779766
(2,4-ditert-butylphenyl) 2-[[2-chloro-5-[(5-chloro-2-methylphenyl)carbamoyl]phenyl]diazenyl]-3-oxobutanoate (PubChem CID 58779766) has the molecular formula C32H35Cl2N3O4 and a molecular weight of 596.56 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) 2-[[2-chloro-5-[(5-chloro-2-methylphenyl)carbamoyl]phenyl]diazenyl]-3-oxobutanoate.
| Compound Name | (2,4-ditert-butylphenyl) 2-[[2-chloro-5-[(5-chloro-2-methylphenyl)carbamoyl]phenyl]diazenyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 58779766 |
| Molecular Formula | C32H35Cl2N3O4 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | (2,4-ditert-butylphenyl) 2-[[2-chloro-5-[(5-chloro-2-methylphenyl)carbamoyl]phenyl]diazenyl]-3-oxobutanoate |
| SMILES | CC(=O)C(/N=N/c1cc(C(=O)Nc2cc(Cl)ccc2C)ccc1Cl)C(=O)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C32H35Cl2N3O4/c1-18-9-12-22(33)17-25(18)35-29(39)20-10-13-24(34)26(15-20)36-37-28(19(2)38)30(40)41-27-14-11-21(31(3,4)5)16-23(27)32(6,7)8/h9-17,28H,1-8H3,(H,35,39)/b37-36+ |
| InChIKey | DTJRXTBNFHNZGL-BSRQYYOTSA-N |
| XLogP | 8.80 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|