C27H25ClINO4 — CID 58780256
ethyl 2-(chloroamino)-3-[4-(3-iodo-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]propanoate (PubChem CID 58780256) has the molecular formula C27H25ClINO4 and a molecular weight of 589.86 g/mol. Its IUPAC name is ethyl 2-(chloroamino)-3-[4-(3-iodo-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]propanoate.
| Compound Name | ethyl 2-(chloroamino)-3-[4-(3-iodo-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 58780256 |
| Molecular Formula | C27H25ClINO4 |
| Molecular Weight | 589.86 g/mol |
| Exact Mass | 589.05 |
| IUPAC Name | ethyl 2-(chloroamino)-3-[4-(3-iodo-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]propanoate |
| SMILES | CCOC(=O)C(Cc1cc2ccccc2c(-c2c(OC)c(I)cc3ccccc23)c1OC)NCl |
| InChI | InChI=1S/C27H25ClINO4/c1-4-34-27(31)22(30-28)15-18-13-16-9-5-7-11-19(16)23(25(18)32-2)24-20-12-8-6-10-17(20)14-21(29)26(24)33-3/h5-14,22,30H,4,15H2,1-3H3 |
| InChIKey | SMPQKOMSMFCBKY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.86 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|