C25H21N4O3+ — CID 58781444
[(1R,2S)-1-(2-nitrophenyl)-3-oxo-3-phenyl-2-pyridin-2-ylpropyl]-pyridin-2-ylazanium (PubChem CID 58781444) has the molecular formula C25H21N4O3+ and a molecular weight of 425.47 g/mol. Its IUPAC name is [(1R,2S)-1-(2-nitrophenyl)-3-oxo-3-phenyl-2-pyridin-2-ylpropyl]-pyridin-2-ylazanium.
| Compound Name | [(1R,2S)-1-(2-nitrophenyl)-3-oxo-3-phenyl-2-pyridin-2-ylpropyl]-pyridin-2-ylazanium |
|---|---|
| PubChem CID | 58781444 |
| Molecular Formula | C25H21N4O3+ |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [(1R,2S)-1-(2-nitrophenyl)-3-oxo-3-phenyl-2-pyridin-2-ylpropyl]-pyridin-2-ylazanium |
| SMILES | O=C(c1ccccc1)[C@H](c1ccccn1)[C@@H]([NH2+]c1ccccn1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20N4O3/c30-25(18-10-2-1-3-11-18)23(20-13-6-8-16-26-20)24(28-22-15-7-9-17-27-22)19-12-4-5-14-21(19)29(31)32/h1-17,23-24H,(H,27,28)/p+1/t23-,24+/m1/s1 |
| InChIKey | BGLUDZCMHGAJKY-RPWUZVMVSA-O |
| XLogP | 3.99 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|