C13H10Cl2N2O2 — CID 7142020
2-[(1R,2R)-1,2-dichloro-2-(2-nitrophenyl)ethyl]pyridine (PubChem CID 7142020) has the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-[(1R,2R)-1,2-dichloro-2-(2-nitrophenyl)ethyl]pyridine.
| Compound Name | 2-[(1R,2R)-1,2-dichloro-2-(2-nitrophenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 7142020 |
| Molecular Formula | C13H10Cl2N2O2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-[(1R,2R)-1,2-dichloro-2-(2-nitrophenyl)ethyl]pyridine |
| SMILES | O=[N+]([O-])c1ccccc1[C@@H](Cl)[C@H](Cl)c1ccccn1 |
| InChI | InChI=1S/C13H10Cl2N2O2/c14-12(13(15)10-6-3-4-8-16-10)9-5-1-2-7-11(9)17(18)19/h1-8,12-13H/t12-,13-/m1/s1 |
| InChIKey | MOTIIKNIYZCCNS-CHWSQXEVSA-N |
| XLogP | 4.25 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|