C25H22N4O3 — CID 58781446
(1R,2R,3S)-3-(2-nitrophenyl)-1-phenyl-2-pyridin-2-yl-3-(pyridin-2-ylamino)propan-1-ol (PubChem CID 58781446) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is (1R,2R,3S)-3-(2-nitrophenyl)-1-phenyl-2-pyridin-2-yl-3-(pyridin-2-ylamino)propan-1-ol.
| Compound Name | (1R,2R,3S)-3-(2-nitrophenyl)-1-phenyl-2-pyridin-2-yl-3-(pyridin-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 58781446 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (1R,2R,3S)-3-(2-nitrophenyl)-1-phenyl-2-pyridin-2-yl-3-(pyridin-2-ylamino)propan-1-ol |
| SMILES | O=[N+]([O-])c1ccccc1[C@@H](Nc1ccccn1)[C@H](c1ccccn1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H22N4O3/c30-25(18-10-2-1-3-11-18)23(20-13-6-8-16-26-20)24(28-22-15-7-9-17-27-22)19-12-4-5-14-21(19)29(31)32/h1-17,23-25,30H,(H,27,28)/t23-,24+,25-/m0/s1 |
| InChIKey | MDQJTCDAAMLRLH-GVAUOCQISA-N |
| XLogP | 5.06 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|