C27H26N3O4- — CID 58782225
(3R,5R)-7-(2,5-diphenyl-4-pyridin-4-ylimidazol-1-yl)-3,5-dihydroxyheptanoate (PubChem CID 58782225) has the molecular formula C27H26N3O4- and a molecular weight of 456.52 g/mol. Its IUPAC name is (3R,5R)-7-(2,5-diphenyl-4-pyridin-4-ylimidazol-1-yl)-3,5-dihydroxyheptanoate.
| Compound Name | (3R,5R)-7-(2,5-diphenyl-4-pyridin-4-ylimidazol-1-yl)-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 58782225 |
| Molecular Formula | C27H26N3O4- |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (3R,5R)-7-(2,5-diphenyl-4-pyridin-4-ylimidazol-1-yl)-3,5-dihydroxyheptanoate |
| SMILES | O=C([O-])C[C@H](O)C[C@H](O)CCn1c(-c2ccccc2)nc(-c2ccncc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H27N3O4/c31-22(17-23(32)18-24(33)34)13-16-30-26(20-7-3-1-4-8-20)25(19-11-14-28-15-12-19)29-27(30)21-9-5-2-6-10-21/h1-12,14-15,22-23,31-32H,13,16-18H2,(H,33,34)/p-1/t22-,23-/m1/s1 |
| InChIKey | XBDBQEXALJGZJF-DHIUTWEWSA-M |
| XLogP | 2.92 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |