C45H54BN5O8 — CID 58785898
CID 58785898 (PubChem CID 58785898) has the molecular formula C45H54BN5O8 and a molecular weight of 803.77 g/mol.
| Compound Name | CID 58785898 |
|---|---|
| PubChem CID | 58785898 |
| Molecular Formula | C45H54BN5O8 |
| Molecular Weight | 803.77 g/mol |
| Exact Mass | 803.41 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H](C(=O)N[C@@H](Cc1cccc2c1CCCC2)C(=O)NC(CCC)C(=O)C(=O)NCC(=O)N[C@H](C(=O)OCc1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C45H54BN5O8/c1-2-15-35(40(53)43(56)47-27-37(52)50-39(32-21-10-5-11-22-32)44(57)59-28-29-16-6-3-7-17-29)48-41(54)36(26-33-24-14-23-30-18-12-13-25-34(30)33)49-42(55)38(51-45(46)58)31-19-8-4-9-20-31/h3,5-7,10-11,14,16-17,21-24,31,35-36,38-39H,2,4,8-9,12-13,15,18-20,25-28H2,1H3,(H,47,56)(H,48,54)(H,49,55)(H,50,52)(H,51,58)/t35?,36-,38-,39-/m0/s1 |
| InChIKey | CVYWYAGPRTVEPI-PGIFXVKYSA-N |
| XLogP | 3.99 |
| TPSA | 188.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|