C25H29N3O — CID 58787439
(E)-4-[3-[1-(1-propylpiperidin-3-yl)benzimidazol-2-yl]phenyl]but-3-en-2-one (PubChem CID 58787439) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is (E)-4-[3-[1-(1-propylpiperidin-3-yl)benzimidazol-2-yl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[3-[1-(1-propylpiperidin-3-yl)benzimidazol-2-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 58787439 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | (E)-4-[3-[1-(1-propylpiperidin-3-yl)benzimidazol-2-yl]phenyl]but-3-en-2-one |
| SMILES | CCCN1CCCC(n2c(-c3cccc(/C=C/C(C)=O)c3)nc3ccccc32)C1 |
| InChI | InChI=1S/C25H29N3O/c1-3-15-27-16-7-10-22(18-27)28-24-12-5-4-11-23(24)26-25(28)21-9-6-8-20(17-21)14-13-19(2)29/h4-6,8-9,11-14,17,22H,3,7,10,15-16,18H2,1-2H3/b14-13+ |
| InChIKey | YMXDFPZWJOROQQ-BUHFOSPRSA-N |
| XLogP | 5.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|