C23H20ClF4NO6 — CID 58787659
3-methylbutanoyloxymethyl 3-(5-chloro-2-methoxyphenyl)-3-fluoro-2-oxo-6-(trifluoromethyl)indole-1-carboxylate (PubChem CID 58787659) has the molecular formula C23H20ClF4NO6 and a molecular weight of 517.86 g/mol. Its IUPAC name is 3-methylbutanoyloxymethyl 3-(5-chloro-2-methoxyphenyl)-3-fluoro-2-oxo-6-(trifluoromethyl)indole-1-carboxylate.
| Compound Name | 3-methylbutanoyloxymethyl 3-(5-chloro-2-methoxyphenyl)-3-fluoro-2-oxo-6-(trifluoromethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 58787659 |
| Molecular Formula | C23H20ClF4NO6 |
| Molecular Weight | 517.86 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 3-methylbutanoyloxymethyl 3-(5-chloro-2-methoxyphenyl)-3-fluoro-2-oxo-6-(trifluoromethyl)indole-1-carboxylate |
| SMILES | COc1ccc(Cl)cc1C1(F)C(=O)N(C(=O)OCOC(=O)CC(C)C)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H20ClF4NO6/c1-12(2)8-19(30)34-11-35-21(32)29-17-9-13(23(26,27)28)4-6-15(17)22(25,20(29)31)16-10-14(24)5-7-18(16)33-3/h4-7,9-10,12H,8,11H2,1-3H3 |
| InChIKey | RQKYGTKYJTVYLV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|