C35H52NO6P-2 — CID 58788007
(Z)-N-[(2S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-phosphonatopropan-2-yl]octadec-9-enamide (PubChem CID 58788007) has the molecular formula C35H52NO6P-2 and a molecular weight of 613.78 g/mol. Its IUPAC name is (Z)-N-[(2S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-phosphonatopropan-2-yl]octadec-9-enamide.
| Compound Name | (Z)-N-[(2S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-phosphonatopropan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 58788007 |
| Molecular Formula | C35H52NO6P-2 |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | (Z)-N-[(2S)-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-3-phosphonatopropan-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](Cc1ccc(OCc2cccc(OC)c2)cc1)CP(=O)([O-])[O-] |
| InChI | InChI=1S/C35H54NO6P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-35(37)36-32(29-43(38,39)40)26-30-22-24-33(25-23-30)42-28-31-19-18-20-34(27-31)41-2/h10-11,18-20,22-25,27,32H,3-9,12-17,21,26,28-29H2,1-2H3,(H,36,37)(H2,38,39,40)/p-2/b11-10-/t32-/m0/s1 |
| InChIKey | MVCIGNYYARWOMO-ZWKXJJLDSA-L |
| XLogP | 7.25 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|