C33H50N2O6P- — CID 171321035
[(2S)-2-[[(Z)-octadec-9-enoyl]amino]-3-[4-(pyridin-2-ylmethoxy)phenyl]propyl] hydrogen phosphate (PubChem CID 171321035) has the molecular formula C33H50N2O6P- and a molecular weight of 601.75 g/mol. Its IUPAC name is [(2S)-2-[[(Z)-octadec-9-enoyl]amino]-3-[4-(pyridin-2-ylmethoxy)phenyl]propyl] hydrogen phosphate.
| Compound Name | [(2S)-2-[[(Z)-octadec-9-enoyl]amino]-3-[4-(pyridin-2-ylmethoxy)phenyl]propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 171321035 |
| Molecular Formula | C33H50N2O6P- |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.34 |
| IUPAC Name | [(2S)-2-[[(Z)-octadec-9-enoyl]amino]-3-[4-(pyridin-2-ylmethoxy)phenyl]propyl] hydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](COP(=O)([O-])O)Cc1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C33H51N2O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-33(36)35-31(28-41-42(37,38)39)26-29-21-23-32(24-22-29)40-27-30-19-17-18-25-34-30/h9-10,17-19,21-25,31H,2-8,11-16,20,26-28H2,1H3,(H,35,36)(H2,37,38,39)/p-1/b10-9-/t31-/m0/s1 |
| InChIKey | XHZMTTZICDAOHN-KKUMVYOXSA-M |
| XLogP | 7.20 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|