C23H33N5O2 — CID 58789650
2-butyl-N-[4-(6-methoxy-3H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]octanamide (PubChem CID 58789650) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-butyl-N-[4-(6-methoxy-3H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]octanamide.
| Compound Name | 2-butyl-N-[4-(6-methoxy-3H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]octanamide |
|---|---|
| PubChem CID | 58789650 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-butyl-N-[4-(6-methoxy-3H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]octanamide |
| SMILES | CCCCCCC(CCCC)C(=O)Nc1ccc(-c2nc3cc(OC)nn3[nH]2)cc1 |
| InChI | InChI=1S/C23H33N5O2/c1-4-6-8-9-11-18(10-7-5-2)23(29)24-19-14-12-17(13-15-19)22-25-20-16-21(30-3)26-28(20)27-22/h12-16,18H,4-11H2,1-3H3,(H,24,29)(H,25,27) |
| InChIKey | ZYJJECNUMNSJGC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|