C21H40O3 — CID 58795465
tert-butyl (3S,5S,6R,7S,8S)-5-hydroxy-3,4,4,6,7,8-hexamethylundec-10-enoate (PubChem CID 58795465) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is tert-butyl (3S,5S,6R,7S,8S)-5-hydroxy-3,4,4,6,7,8-hexamethylundec-10-enoate.
| Compound Name | tert-butyl (3S,5S,6R,7S,8S)-5-hydroxy-3,4,4,6,7,8-hexamethylundec-10-enoate |
|---|---|
| PubChem CID | 58795465 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | tert-butyl (3S,5S,6R,7S,8S)-5-hydroxy-3,4,4,6,7,8-hexamethylundec-10-enoate |
| SMILES | C=CC[C@H](C)[C@H](C)[C@@H](C)[C@H](O)C(C)(C)[C@@H](C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40O3/c1-11-12-14(2)16(4)17(5)19(23)21(9,10)15(3)13-18(22)24-20(6,7)8/h11,14-17,19,23H,1,12-13H2,2-10H3/t14-,15-,16-,17+,19-/m0/s1 |
| InChIKey | KNRMCYXSQKLSJR-CWLGOENISA-N |
| XLogP | 5.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|