C18H32O5 — CID 71479496
tert-butyl (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate (PubChem CID 71479496) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate.
| Compound Name | tert-butyl (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 71479496 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
| SMILES | C=C[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32O5/c1-9-11(2)15(21)12(3)16(22)18(7,8)13(19)10-14(20)23-17(4,5)6/h9,11-13,15,19,21H,1,10H2,2-8H3/t11-,12+,13-,15-/m0/s1 |
| InChIKey | AMBYSRBHWFSIQZ-XFMPKHEZSA-N |
| XLogP | 2.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|