C19H29F3O5 — CID 143101005
(3S,9E,12E)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxo-12-(trifluoromethyl)tetradeca-9,12-dienoic acid (PubChem CID 143101005) has the molecular formula C19H29F3O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (3S,9E,12E)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxo-12-(trifluoromethyl)tetradeca-9,12-dienoic acid.
| Compound Name | (3S,9E,12E)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxo-12-(trifluoromethyl)tetradeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 143101005 |
| Molecular Formula | C19H29F3O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3S,9E,12E)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxo-12-(trifluoromethyl)tetradeca-9,12-dienoic acid |
| SMILES | C/C=C(\C/C=C/C(C)C(O)C(C)C(=O)C(C)(C)[C@@H](O)CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C19H29F3O5/c1-6-13(19(20,21)22)9-7-8-11(2)16(26)12(3)17(27)18(4,5)14(23)10-15(24)25/h6-8,11-12,14,16,23,26H,9-10H2,1-5H3,(H,24,25)/b8-7+,13-6+/t11?,12?,14-,16?/m0/s1 |
| InChIKey | OUNODHGNGCCRTF-MEXIWCEQSA-N |
| XLogP | 3.51 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|