C20H31FO4 — CID 142099523
(11E,13E)-13-(fluoromethyl)-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142099523) has the molecular formula C20H31FO4 and a molecular weight of 354.46 g/mol. Its IUPAC name is (11E,13E)-13-(fluoromethyl)-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (11E,13E)-13-(fluoromethyl)-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142099523 |
| Molecular Formula | C20H31FO4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (11E,13E)-13-(fluoromethyl)-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1C/C=C/C(CF)=C/CCOC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H31FO4/c1-14-7-5-8-16(13-21)9-6-10-25-18(23)12-17(22)20(3,4)19(24)15(2)11-14/h5,8-9,14-15,17,22H,6-7,10-13H2,1-4H3/b8-5+,16-9- |
| InChIKey | YYPSZSBKRHQRDG-FJGPGAONSA-N |
| XLogP | 3.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |