C18H32O5 — CID 10268349
(3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5-oxotridec-12-enoic acid (PubChem CID 10268349) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5-oxotridec-12-enoic acid.
| Compound Name | (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5-oxotridec-12-enoic acid |
|---|---|
| PubChem CID | 10268349 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5-oxotridec-12-enoic acid |
| SMILES | C=C(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C18H32O5/c1-11(2)8-7-9-12(3)16(22)13(4)17(23)18(5,6)14(19)10-15(20)21/h12-14,16,19,22H,1,7-10H2,2-6H3,(H,20,21)/t12-,13+,14-,16-/m0/s1 |
| InChIKey | DHKKRIJLMXHNIR-FQLMCAECSA-N |
| XLogP | 2.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|