C36H64O10 — CID 139040615
tert-butyl (3R,6R,7R,8R)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate;tert-butyl (3S,6S,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate (PubChem CID 139040615) has the molecular formula C36H64O10 and a molecular weight of 656.90 g/mol. Its IUPAC name is tert-butyl (3R,6R,7R,8R)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate;tert-butyl (3S,6S,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate.
| Compound Name | tert-butyl (3R,6R,7R,8R)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate;tert-butyl (3S,6S,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 139040615 |
| Molecular Formula | C36H64O10 |
| Molecular Weight | 656.90 g/mol |
| Exact Mass | 656.45 |
| IUPAC Name | tert-butyl (3R,6R,7R,8R)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate;tert-butyl (3S,6S,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)OC(C)(C)C.C=C[C@H](C)[C@H](O)[C@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/2C18H32O5/c2*1-9-11(2)15(21)12(3)16(22)18(7,8)13(19)10-14(20)23-17(4,5)6/h2*9,11-13,15,19,21H,1,10H2,2-8H3/t2*11-,12-,13-,15-/m10/s1 |
| InChIKey | VPZOFVIBXUZXKR-FYWNOMMDSA-N |
| XLogP | 4.99 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|