C14H24O3 — CID 162403349
ethyl (4R)-4-(1-hydroxycyclohexyl)hex-5-enoate (PubChem CID 162403349) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is ethyl (4R)-4-(1-hydroxycyclohexyl)hex-5-enoate.
| Compound Name | ethyl (4R)-4-(1-hydroxycyclohexyl)hex-5-enoate |
|---|---|
| PubChem CID | 162403349 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | ethyl (4R)-4-(1-hydroxycyclohexyl)hex-5-enoate |
| SMILES | C=C[C@@H](CCC(=O)OCC)C1(O)CCCCC1 |
| InChI | InChI=1S/C14H24O3/c1-3-12(8-9-13(15)17-4-2)14(16)10-6-5-7-11-14/h3,12,16H,1,4-11H2,2H3/t12-/m0/s1 |
| InChIKey | XXXLLNIOSIENFC-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|