C14H20N3+ — CID 58798045
4-[(4-butan-2-ylphenyl)methyl]-1-methyl-1,2,4-triazol-4-ium (PubChem CID 58798045) has the molecular formula C14H20N3+ and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-[(4-butan-2-ylphenyl)methyl]-1-methyl-1,2,4-triazol-4-ium.
| Compound Name | 4-[(4-butan-2-ylphenyl)methyl]-1-methyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 58798045 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4-[(4-butan-2-ylphenyl)methyl]-1-methyl-1,2,4-triazol-4-ium |
| SMILES | CCC(C)c1ccc(C[n+]2cnn(C)c2)cc1 |
| InChI | InChI=1S/C14H20N3/c1-4-12(2)14-7-5-13(6-8-14)9-17-10-15-16(3)11-17/h5-8,10-12H,4,9H2,1-3H3/q+1 |
| InChIKey | LRORPCSPPVMTIT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|