C29H31F2N7O4 — CID 58799074
N'-[3-fluoro-4-[5-methyl-6-[(2-morpholin-4-ylethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-N-(4-fluorophenyl)propanediamide (PubChem CID 58799074) has the molecular formula C29H31F2N7O4 and a molecular weight of 579.61 g/mol. Its IUPAC name is N'-[3-fluoro-4-[5-methyl-6-[(2-morpholin-4-ylethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-N-(4-fluorophenyl)propanediamide.
| Compound Name | N'-[3-fluoro-4-[5-methyl-6-[(2-morpholin-4-ylethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-N-(4-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 58799074 |
| Molecular Formula | C29H31F2N7O4 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | N'-[3-fluoro-4-[5-methyl-6-[(2-morpholin-4-ylethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-N-(4-fluorophenyl)propanediamide |
| SMILES | Cc1c(CNCCN2CCOCC2)cn2ncnc(Oc3ccc(NC(=O)CC(=O)Nc4ccc(F)cc4)cc3F)c12 |
| InChI | InChI=1S/C29H31F2N7O4/c1-19-20(16-32-8-9-37-10-12-41-13-11-37)17-38-28(19)29(33-18-34-38)42-25-7-6-23(14-24(25)31)36-27(40)15-26(39)35-22-4-2-21(30)3-5-22/h2-7,14,17-18,32H,8-13,15-16H2,1H3,(H,35,39)(H,36,40) |
| InChIKey | BQWKANPACPSXHN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|