C10H17NO3 — CID 58805083
[(E)-5-hydroxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate (PubChem CID 58805083) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is [(E)-5-hydroxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate.
| Compound Name | [(E)-5-hydroxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 58805083 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(E)-5-hydroxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate |
| SMILES | C=C(/C=C/CO)COC(=O)NC(C)C |
| InChI | InChI=1S/C10H17NO3/c1-8(2)11-10(13)14-7-9(3)5-4-6-12/h4-5,8,12H,3,6-7H2,1-2H3,(H,11,13)/b5-4+ |
| InChIKey | FCBVLLRXRLJUBN-SNAWJCMRSA-N |
| XLogP | 1.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|