C21H21FO2 — CID 58805484
3-(3-fluoro-4-methylphenyl)-5-hydroxy-2-(3,4,5-trimethylphenyl)cyclopent-2-en-1-one (PubChem CID 58805484) has the molecular formula C21H21FO2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-5-hydroxy-2-(3,4,5-trimethylphenyl)cyclopent-2-en-1-one.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-5-hydroxy-2-(3,4,5-trimethylphenyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 58805484 |
| Molecular Formula | C21H21FO2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-5-hydroxy-2-(3,4,5-trimethylphenyl)cyclopent-2-en-1-one |
| SMILES | Cc1ccc(C2=C(c3cc(C)c(C)c(C)c3)C(=O)C(O)C2)cc1F |
| InChI | InChI=1S/C21H21FO2/c1-11-5-6-15(9-18(11)22)17-10-19(23)21(24)20(17)16-7-12(2)14(4)13(3)8-16/h5-9,19,23H,10H2,1-4H3 |
| InChIKey | DMURNSSJNQZNCH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|