C28H29N3O2 — CID 58805699
N-[(E)-[6-(oxiran-2-ylmethoxy)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl]methylideneamino]-N-phenylaniline (PubChem CID 58805699) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[(E)-[6-(oxiran-2-ylmethoxy)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl]methylideneamino]-N-phenylaniline.
| Compound Name | N-[(E)-[6-(oxiran-2-ylmethoxy)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl]methylideneamino]-N-phenylaniline |
|---|---|
| PubChem CID | 58805699 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[(E)-[6-(oxiran-2-ylmethoxy)-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl]methylideneamino]-N-phenylaniline |
| SMILES | C(=N/N(c1ccccc1)c1ccccc1)\c1cc2c3c(c1OCC1CO1)CCCN3CCC2 |
| InChI | InChI=1S/C28H29N3O2/c1-3-10-23(11-4-1)31(24-12-5-2-6-13-24)29-18-22-17-21-9-7-15-30-16-8-14-26(27(21)30)28(22)33-20-25-19-32-25/h1-6,10-13,17-18,25H,7-9,14-16,19-20H2/b29-18+ |
| InChIKey | XWLBWZIHAOIDCP-RDRPBHBLSA-N |
| XLogP | 5.34 |
| TPSA | 40.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|