C33H36N4O4 — CID 58808370
N-[(1S,2R)-2-[2-(4-methoxyanilino)ethylcarbamoyl]cyclohexyl]-4-(quinolin-4-ylmethoxy)benzamide (PubChem CID 58808370) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is N-[(1S,2R)-2-[2-(4-methoxyanilino)ethylcarbamoyl]cyclohexyl]-4-(quinolin-4-ylmethoxy)benzamide.
| Compound Name | N-[(1S,2R)-2-[2-(4-methoxyanilino)ethylcarbamoyl]cyclohexyl]-4-(quinolin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 58808370 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | N-[(1S,2R)-2-[2-(4-methoxyanilino)ethylcarbamoyl]cyclohexyl]-4-(quinolin-4-ylmethoxy)benzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@@H]2CCCC[C@@H]2NC(=O)c2ccc(OCc3ccnc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C33H36N4O4/c1-40-26-16-12-25(13-17-26)34-20-21-36-33(39)29-7-3-5-9-31(29)37-32(38)23-10-14-27(15-11-23)41-22-24-18-19-35-30-8-4-2-6-28(24)30/h2,4,6,8,10-19,29,31,34H,3,5,7,9,20-22H2,1H3,(H,36,39)(H,37,38)/t29-,31+/m1/s1 |
| InChIKey | FMBLFMYKZQLSDK-VEEOACQBSA-N |
| XLogP | 5.34 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|