C16H15F2NO3 — CID 58811248
3-[bis(4-fluorophenyl)methoxy]-N-hydroxypropanamide (PubChem CID 58811248) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-[bis(4-fluorophenyl)methoxy]-N-hydroxypropanamide.
| Compound Name | 3-[bis(4-fluorophenyl)methoxy]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 58811248 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[bis(4-fluorophenyl)methoxy]-N-hydroxypropanamide |
| SMILES | O=C(CCOC(c1ccc(F)cc1)c1ccc(F)cc1)NO |
| InChI | InChI=1S/C16H15F2NO3/c17-13-5-1-11(2-6-13)16(22-10-9-15(20)19-21)12-3-7-14(18)8-4-12/h1-8,16,21H,9-10H2,(H,19,20) |
| InChIKey | ALGHJCMPGGBOAQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|