C15H13F2NO3S — CID 129385832
2-[(S)-bis(4-fluorophenyl)methylsulfinyl]-N-hydroxyacetamide (PubChem CID 129385832) has the molecular formula C15H13F2NO3S and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-[(S)-bis(4-fluorophenyl)methylsulfinyl]-N-hydroxyacetamide.
| Compound Name | 2-[(S)-bis(4-fluorophenyl)methylsulfinyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 129385832 |
| Molecular Formula | C15H13F2NO3S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[(S)-bis(4-fluorophenyl)methylsulfinyl]-N-hydroxyacetamide |
| SMILES | O=C(C[S@](=O)C(c1ccc(F)cc1)c1ccc(F)cc1)NO |
| InChI | InChI=1S/C15H13F2NO3S/c16-12-5-1-10(2-6-12)15(22(21)9-14(19)18-20)11-3-7-13(17)8-4-11/h1-8,15,20H,9H2,(H,18,19)/t22-/m0/s1 |
| InChIKey | VKGUUSVYPXTWMA-QFIPXVFZSA-N |
| XLogP | 2.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|