C9H8Cl3N3O2 — CID 58812787
1-chloroethyl 2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 58812787) has the molecular formula C9H8Cl3N3O2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 1-chloroethyl 2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate.
| Compound Name | 1-chloroethyl 2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 58812787 |
| Molecular Formula | C9H8Cl3N3O2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 1-chloroethyl 2,4-dichloro-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | CC(Cl)OC(=O)N1Cc2nc(Cl)nc(Cl)c2C1 |
| InChI | InChI=1S/C9H8Cl3N3O2/c1-4(10)17-9(16)15-2-5-6(3-15)13-8(12)14-7(5)11/h4H,2-3H2,1H3 |
| InChIKey | GUHSHWCRWUBAOS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|