C23H26FN5O4 — CID 58824948
3-(3-fluoroanilino)-N-[2-(2-hydroxyethylamino)ethyl]-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-1-carboxamide (PubChem CID 58824948) has the molecular formula C23H26FN5O4 and a molecular weight of 455.49 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-N-[2-(2-hydroxyethylamino)ethyl]-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-1-carboxamide.
| Compound Name | 3-(3-fluoroanilino)-N-[2-(2-hydroxyethylamino)ethyl]-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 58824948 |
| Molecular Formula | C23H26FN5O4 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-(3-fluoroanilino)-N-[2-(2-hydroxyethylamino)ethyl]-6,7-dimethoxy-4H-indeno[2,1-d]pyrazole-1-carboxamide |
| SMILES | COc1cc2c(cc1OC)-c1c(c(Nc3cccc(F)c3)nn1C(=O)NCCNCCO)C2 |
| InChI | InChI=1S/C23H26FN5O4/c1-32-19-11-14-10-18-21(17(14)13-20(19)33-2)29(23(31)26-7-6-25-8-9-30)28-22(18)27-16-5-3-4-15(24)12-16/h3-5,11-13,25,30H,6-10H2,1-2H3,(H,26,31)(H,27,28) |
| InChIKey | HZVSJRBMBWSRET-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|