C22H25FN3O5P — CID 58824856
1-diethoxyphosphoryl-N-(3-fluorophenyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazol-3-amine (PubChem CID 58824856) has the molecular formula C22H25FN3O5P and a molecular weight of 461.43 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-(3-fluorophenyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazol-3-amine.
| Compound Name | 1-diethoxyphosphoryl-N-(3-fluorophenyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 58824856 |
| Molecular Formula | C22H25FN3O5P |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-diethoxyphosphoryl-N-(3-fluorophenyl)-6,7-dimethoxy-4H-indeno[2,1-d]pyrazol-3-amine |
| SMILES | CCOP(=O)(OCC)n1nc(Nc2cccc(F)c2)c2c1-c1cc(OC)c(OC)cc1C2 |
| InChI | InChI=1S/C22H25FN3O5P/c1-5-30-32(27,31-6-2)26-21-17-13-20(29-4)19(28-3)11-14(17)10-18(21)22(25-26)24-16-9-7-8-15(23)12-16/h7-9,11-13H,5-6,10H2,1-4H3,(H,24,25) |
| InChIKey | CYGRHGZGRIUAAP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|