C34H25GaN2O3S — CID 58825883
bis[(2-methylquinolin-8-yl)oxy]-[(2-phenyl-1-benzothiophen-3-yl)oxy]gallane (PubChem CID 58825883) has the molecular formula C34H25GaN2O3S and a molecular weight of 611.38 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]-[(2-phenyl-1-benzothiophen-3-yl)oxy]gallane.
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]-[(2-phenyl-1-benzothiophen-3-yl)oxy]gallane |
|---|---|
| PubChem CID | 58825883 |
| Molecular Formula | C34H25GaN2O3S |
| Molecular Weight | 611.38 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]-[(2-phenyl-1-benzothiophen-3-yl)oxy]gallane |
| SMILES | Cc1ccc2cccc(O[Ga](Oc3c(-c4ccccc4)sc4ccccc34)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C14H10OS.2C10H9NO.Ga/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-9,15H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | FVIPYNBGRNJXFP-UHFFFAOYSA-K |
| XLogP | 8.80 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.38 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |