C20H22BrN — CID 58827029
(4aS,9bR)-2-benzyl-8-bromo-6-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine (PubChem CID 58827029) has the molecular formula C20H22BrN and a molecular weight of 356.31 g/mol. Its IUPAC name is (4aS,9bR)-2-benzyl-8-bromo-6-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine.
| Compound Name | (4aS,9bR)-2-benzyl-8-bromo-6-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine |
|---|---|
| PubChem CID | 58827029 |
| Molecular Formula | C20H22BrN |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (4aS,9bR)-2-benzyl-8-bromo-6-methyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine |
| SMILES | Cc1cc(Br)cc2c1C[C@H]1CCN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C20H22BrN/c1-14-9-17(21)11-19-18(14)10-16-7-8-22(13-20(16)19)12-15-5-3-2-4-6-15/h2-6,9,11,16,20H,7-8,10,12-13H2,1H3/t16-,20-/m1/s1 |
| InChIKey | DTWQHNLIIRTFKA-OXQOHEQNSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |