C39H37F5O4S — CID 58830669
2-(4-methoxyphenyl)-1-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]-6-phenylmethoxynaphthalene (PubChem CID 58830669) has the molecular formula C39H37F5O4S and a molecular weight of 696.78 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]-6-phenylmethoxynaphthalene.
| Compound Name | 2-(4-methoxyphenyl)-1-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]-6-phenylmethoxynaphthalene |
|---|---|
| PubChem CID | 58830669 |
| Molecular Formula | C39H37F5O4S |
| Molecular Weight | 696.78 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]-6-phenylmethoxynaphthalene |
| SMILES | COc1ccc(-c2ccc3cc(OCc4ccccc4)ccc3c2Oc2ccc(OCCCCSCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C39H37F5O4S/c1-45-31-13-10-29(11-14-31)35-20-12-30-26-34(47-27-28-8-3-2-4-9-28)19-21-36(30)37(35)48-33-17-15-32(16-18-33)46-23-5-6-24-49-25-7-22-38(40,41)39(42,43)44/h2-4,8-21,26H,5-7,22-25,27H2,1H3 |
| InChIKey | GUPIVWLKOQQGRH-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.78 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|