C36H41F3O6SSi — CID 10580460
[3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 10580460) has the molecular formula C36H41F3O6SSi and a molecular weight of 686.87 g/mol. Its IUPAC name is [3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10580460 |
| Molecular Formula | C36H41F3O6SSi |
| Molecular Weight | 686.87 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | [3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OC)c2cc(OS(=O)(=O)C(F)(F)F)c(CCC/C(C)=C\CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc12 |
| InChI | InChI=1S/C36H41F3O6SSi/c1-26(22-23-44-47(35(2,3)4,28-16-9-7-10-17-28)29-18-11-8-12-19-29)14-13-15-27-24-30-31(33(43-6)21-20-32(30)42-5)25-34(27)45-46(40,41)36(37,38)39/h7-12,16-22,24-25H,13-15,23H2,1-6H3/b26-22- |
| InChIKey | JLVSTNWALPDDCO-ROMGYVFFSA-N |
| XLogP | 7.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.87 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|