C17H13F3O5S — CID 15419856
(1,8-dimethoxyanthracen-9-yl) trifluoromethanesulfonate (PubChem CID 15419856) has the molecular formula C17H13F3O5S and a molecular weight of 386.35 g/mol. Its IUPAC name is (1,8-dimethoxyanthracen-9-yl) trifluoromethanesulfonate.
| Compound Name | (1,8-dimethoxyanthracen-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15419856 |
| Molecular Formula | C17H13F3O5S |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (1,8-dimethoxyanthracen-9-yl) trifluoromethanesulfonate |
| SMILES | COc1cccc2cc3cccc(OC)c3c(OS(=O)(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C17H13F3O5S/c1-23-12-7-3-5-10-9-11-6-4-8-13(24-2)15(11)16(14(10)12)25-26(21,22)17(18,19)20/h3-9H,1-2H3 |
| InChIKey | KNRFRTPUWBZMQK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|