C34H37F3O4SSi — CID 11006681
[3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 11006681) has the molecular formula C34H37F3O4SSi and a molecular weight of 626.81 g/mol. Its IUPAC name is [3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11006681 |
| Molecular Formula | C34H37F3O4SSi |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [3-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | C/C(=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCCc1cc2ccccc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C34H37F3O4SSi/c1-26(22-23-40-43(33(2,3)4,30-18-7-5-8-19-30)31-20-9-6-10-21-31)14-13-17-29-24-27-15-11-12-16-28(27)25-32(29)41-42(38,39)34(35,36)37/h5-12,15-16,18-22,24-25H,13-14,17,23H2,1-4H3/b26-22- |
| InChIKey | UFRWTXXSFLFYKC-ROMGYVFFSA-N |
| XLogP | 7.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|