C30H22F6O6S2 — CID 71813894
[4-[11-[4-(trifluoromethylsulfonyloxy)phenyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phenyl] trifluoromethanesulfonate (PubChem CID 71813894) has the molecular formula C30H22F6O6S2 and a molecular weight of 656.62 g/mol. Its IUPAC name is [4-[11-[4-(trifluoromethylsulfonyloxy)phenyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[11-[4-(trifluoromethylsulfonyloxy)phenyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71813894 |
| Molecular Formula | C30H22F6O6S2 |
| Molecular Weight | 656.62 g/mol |
| Exact Mass | 656.08 |
| IUPAC Name | [4-[11-[4-(trifluoromethylsulfonyloxy)phenyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cc3ccc2CCc2ccc(c(-c4ccc(OS(=O)(=O)C(F)(F)F)cc4)c2)CC3)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H22F6O6S2/c31-29(32,33)43(37,38)41-25-13-9-23(10-14-25)27-17-19-1-5-21(27)8-4-20-2-6-22(7-3-19)28(18-20)24-11-15-26(16-12-24)42-44(39,40)30(34,35)36/h1-2,5-6,9-18H,3-4,7-8H2 |
| InChIKey | UBMYPRYTVIBUIL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|